CAS 1187932-47-3

3-Isoquinolinemethanamine, 1,2,3,4-tetrahydro-, hydrochloride (1:2), (3R)-

Description:

3-Isoquinolinemethanamine, 1,2,3,4-tetrahydro-, hydrochloride (1:2), (3R)- is a chemical compound characterized by its isoquinoline structure, which is a bicyclic aromatic compound. This substance features a tetrahydroisoquinoline moiety, indicating that it has undergone partial hydrogenation, resulting in a saturated ring system. The presence of the amine functional group suggests potential basic properties, making it soluble in polar solvents, particularly water, due to the formation of hydrochloride salt. The (3R)- designation indicates a specific stereochemistry, which can influence its biological activity and interactions with receptors or enzymes. This compound may be of interest in medicinal chemistry, particularly for its potential pharmacological properties, as isoquinoline derivatives are often explored for their roles in various biological activities, including neuroactivity and anti-cancer effects. As with many chemical substances, safety data and handling precautions should be considered, especially when dealing with hydrochloride salts, which can be corrosive and require appropriate safety measures during use.

Formula: C₁₀H₁₄N₂·2ClH

InChI: InChI=1S/C10H14N2.2ClH/c11-6-10-5-8-3-1-2-4-9(8)7-12-10;;/h1-4,10,12H,5-7,11H2;2*1H/t10-;;/m1../s1

InChI key: InChIKey=HSSUKJOECDCYRF-YQFADDPSSA-N

SMILES: C(N)[C@H]1CC=2C(CN1)=CC=CC2.Cl

Synonyms:

• 3-Isoquinolinemethanamine, 1,2,3,4-tetrahydro-, hydrochloride (1:2), (3R)-