
CAS 1187932-48-4
:Pyridine, 3-bromo-5-methyl-, hydrochloride (1:1)
Description:
Pyridine, 3-bromo-5-methyl-, hydrochloride (1:1) is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. The presence of a bromine atom at the 3-position and a methyl group at the 5-position of the pyridine ring contributes to its unique reactivity and properties. As a hydrochloride salt, it is typically encountered in a solid form, which enhances its solubility in polar solvents, particularly water. This compound is often used in organic synthesis and as an intermediate in the production of pharmaceuticals and agrochemicals. Its properties include being a weak base due to the nitrogen atom in the ring, which can participate in protonation. The bromine substituent can serve as a site for nucleophilic substitution reactions, making it valuable in various chemical transformations. Safety precautions should be taken when handling this compound, as it may pose health risks, including irritation to the skin and respiratory system.
Formula:C6H6BrN·ClH
InChI:InChI=1S/C6H6BrN.ClH/c1-5-2-6(7)4-8-3-5;/h2-4H,1H3;1H
InChI key:InChIKey=MWCSNNKRDJKWPO-UHFFFAOYSA-N
SMILES:BrC=1C=C(C)C=NC1.Cl
Synonyms:- Pyridine, 3-bromo-5-methyl-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
