CymitQuimica logo

CAS 1187932-50-8

:

Cyclopropanamine, 1-(3-pyridinyl)-, hydrochloride (1:2)

Description:
Cyclopropanamine, 1-(3-pyridinyl)-, hydrochloride (1:2) is a chemical compound characterized by its cyclopropane structure fused with an amine group and a pyridine ring. The presence of the pyridine moiety imparts unique properties, including potential biological activity, as pyridine derivatives are often found in pharmaceuticals. The hydrochloride form indicates that the compound is a salt, which typically enhances its solubility in water and stability. This compound may exhibit basic properties due to the amine group, allowing it to participate in various chemical reactions, including nucleophilic substitutions. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of drugs targeting neurological or psychiatric conditions, given the relevance of both cyclopropane and pyridine derivatives in such contexts. As with many amines, it may also exhibit varying degrees of toxicity and should be handled with appropriate safety measures in laboratory settings. Further studies would be necessary to fully elucidate its pharmacological profile and potential uses.
Formula:C8H10N2·2ClH
InChI:InChI=1S/C8H10N2.2ClH/c9-8(3-4-8)7-2-1-5-10-6-7;;/h1-2,5-6H,3-4,9H2;2*1H
InChI key:InChIKey=CTOQLERDGYBWAV-UHFFFAOYSA-N
SMILES:NC1(CC1)C=2C=CC=NC2.Cl
Synonyms:
  • 1-(Pyridin-3-yl)cyclopropanamine dihydrochloride
  • Cyclopropanamine, 1-(3-pyridinyl)-, hydrochloride (1:2)
Found 4 products.