CymitQuimica logo

CAS 1187932-52-0

:

8-Bromo-1,2,3,4-tetrahydro-1,4,4-trimethylquinoline

Description:
8-Bromo-1,2,3,4-tetrahydro-1,4,4-trimethylquinoline is a chemical compound characterized by its unique structure, which includes a quinoline core with a bromine substituent and multiple methyl groups. This compound is part of the larger family of quinolines, which are known for their aromatic properties and biological activity. The presence of the bromine atom introduces notable reactivity, making it a potential candidate for various chemical reactions, including electrophilic substitutions. The tetrahydro structure indicates that it contains a saturated ring system, which can influence its physical properties, such as solubility and boiling point. Additionally, the trimethyl groups contribute to steric hindrance, potentially affecting its interaction with other molecules. This compound may exhibit interesting pharmacological properties, as many quinoline derivatives are known for their biological activities, including antimicrobial and antimalarial effects. However, specific applications and safety profiles would require further investigation and research.
Formula:C12H16BrN
InChI:InChI=1S/C12H16BrN/c1-12(2)7-8-14(3)11-9(12)5-4-6-10(11)13/h4-6H,7-8H2,1-3H3
InChI key:InChIKey=NEQBYOCYQSSTGA-UHFFFAOYSA-N
SMILES:CC1(C)C=2C(N(C)CC1)=C(Br)C=CC2
Synonyms:
  • 8-Bromo-1,2,3,4-tetrahydro-1,4,4-trimethylquinoline
  • Quinoline, 8-bromo-1,2,3,4-tetrahydro-1,4,4-trimethyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.