CAS 1187932-55-3

4-Pyridinemethanol, 2-amino-α-methyl-, ethanedioate (1:1)

Description:

4-Pyridinemethanol, 2-amino-α-methyl-, ethanedioate (1:1), identified by the CAS number 1187932-55-3, is a chemical compound that features a pyridine ring substituted with a hydroxymethyl group and an amino group, along with an ethanedioate moiety. This compound typically exhibits characteristics associated with both pyridine derivatives and carboxylic acid salts. It is likely to be a solid at room temperature, with potential solubility in polar solvents due to the presence of hydroxyl and amino functional groups. The compound may display basic properties due to the nitrogen in the pyridine ring and the amino group, which can participate in hydrogen bonding. Its ethanedioate component suggests potential for forming salts or complexes, which can influence its reactivity and stability. Additionally, the presence of multiple functional groups may allow for various chemical reactions, making it of interest in synthetic organic chemistry and potential applications in pharmaceuticals or agrochemicals. However, specific physical and chemical properties such as melting point, boiling point, and reactivity would require empirical data for precise characterization.

Formula: C₇H₁₀N₂O·C₂H₂O₄

InChI: InChI=1S/C7H10N2O.C2H2O4/c1-5(10)6-2-3-9-7(8)4-6;3-1(4)2(5)6/h2-5,10H,1H3,(H2,8,9);(H,3,4)(H,5,6)

InChI key: InChIKey=ORYNAFXRTADNAK-UHFFFAOYSA-N

SMILES: C(C)(O)C=1C=C(N)N=CC1.C(C(O)=O)(O)=O

Synonyms:

• 4-Pyridinemethanol, 2-amino-α-methyl-, ethanedioate (1:1)