CymitQuimica logo

CAS 1187932-57-5

:

3-(2-Pyrrolidinyl)benzoic acid

Description:
3-(2-Pyrrolidinyl)benzoic acid is an organic compound characterized by its unique structure, which features a benzoic acid moiety substituted with a pyrrolidine ring. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential biological activity. The presence of the carboxylic acid functional group imparts acidic characteristics, allowing it to participate in various chemical reactions, including esterification and amidation. The pyrrolidine ring, a five-membered nitrogen-containing heterocycle, can influence the compound's solubility and reactivity, making it of interest in medicinal chemistry and drug design. Additionally, the compound may exhibit specific interactions with biological targets, which could be explored for therapeutic applications. Its molecular weight, melting point, and solubility characteristics would depend on the specific conditions and purity of the sample. Overall, 3-(2-Pyrrolidinyl)benzoic acid represents a versatile structure with potential implications in various fields, including pharmaceuticals and materials science.
Formula:C11H13NO2
InChI:InChI=1S/C11H13NO2/c13-11(14)9-4-1-3-8(7-9)10-5-2-6-12-10/h1,3-4,7,10,12H,2,5-6H2,(H,13,14)
InChI key:InChIKey=QFVDUGCRHXDSRI-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C=C(C=CC1)C2CCCN2
Synonyms:
  • Benzoic acid, 3-(2-pyrrolidinyl)-
  • 3-(2-Pyrrolidinyl)benzoic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.