CAS 1187932-61-1

3-Pyridineethanol, 2-amino-, ethanedioate (1:1)

Description:

3-Pyridineethanol, 2-amino-, ethanedioate (1:1), identified by its CAS number 1187932-61-1, is a chemical compound that features a pyridine ring substituted with an ethanol group and an amino group, along with an ethanedioate moiety. This compound typically exhibits characteristics associated with both its pyridine and amino functionalities, such as being polar and capable of forming hydrogen bonds, which can influence its solubility in water and organic solvents. The presence of the ethanedioate (oxalate) component suggests potential for chelation with metal ions, making it of interest in coordination chemistry. Additionally, the amino group may impart basic properties, allowing the compound to participate in various chemical reactions, including nucleophilic substitutions and acid-base interactions. Its structural features may also contribute to biological activity, making it relevant in pharmaceutical applications. Overall, this compound's unique combination of functional groups positions it as a versatile entity in both synthetic and biological chemistry contexts.

Formula: C₇H₁₀N₂O·C₂H₂O₄

InChI: InChI=1S/C7H10N2O.C2H2O4/c8-7-6(3-5-10)2-1-4-9-7;3-1(4)2(5)6/h1-2,4,10H,3,5H2,(H2,8,9);(H,3,4)(H,5,6)

InChI key: InChIKey=YYBZGQXDPNXTSF-UHFFFAOYSA-N

SMILES: C(CO)C1=C(N)N=CC=C1.C(C(O)=O)(O)=O

Synonyms:

• 3-Pyridineethanol, 2-amino-, ethanedioate (1:1)