CAS 1187932-74-6

4-Pyridinecarboxylic acid, 2-(hexahydro-1H-azepin-1-yl)-, hydrochloride (1:1)

Description:

4-Pyridinecarboxylic acid, 2-(hexahydro-1H-azepin-1-yl)-, hydrochloride (1:1) is a chemical compound characterized by its pyridine and azepine moieties. The presence of the pyridine ring contributes to its aromatic properties, while the hexahydro-1H-azepin structure introduces a saturated cyclic amine, which can influence its reactivity and solubility. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its potential applications in pharmaceutical formulations. The compound may exhibit biological activity due to the functional groups present, making it of interest in medicinal chemistry. Its molecular structure suggests potential interactions with biological targets, which could be explored for therapeutic purposes. Additionally, the compound's stability, melting point, and specific reactivity would depend on the conditions under which it is handled, including pH and temperature. Overall, this compound represents a unique combination of features that could be valuable in various chemical and pharmaceutical applications.

Formula: C₁₂H₁₆N₂O₂·ClH

InChI: InChI=1S/C12H16N2O2.ClH/c15-12(16)10-5-6-13-11(9-10)14-7-3-1-2-4-8-14;/h5-6,9H,1-4,7-8H2,(H,15,16);1H

InChI key: InChIKey=WDOJMEKUDUOIMA-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C=C(N=CC1)N2CCCCCC2.Cl

Synonyms:

• 4-Pyridinecarboxylic acid, 2-(hexahydro-1H-azepin-1-yl)-, hydrochloride (1:1)