
CAS 1187932-76-8
:4-Thiazolemethanamine, 2-(phenylmethyl)-, hydrochloride (1:2)
Description:
4-Thiazolemethanamine, 2-(phenylmethyl)-, hydrochloride (1:2) is a chemical compound characterized by its thiazole ring structure, which contributes to its biological activity. This compound features a phenylmethyl group, enhancing its lipophilicity and potential interactions with biological targets. As a hydrochloride salt, it is typically more soluble in water, facilitating its use in various applications, including pharmaceuticals. The presence of the thiazole moiety suggests potential antimicrobial or antifungal properties, as thiazole derivatives are often explored for their biological activities. The compound's molecular structure may also influence its pharmacokinetics, including absorption, distribution, metabolism, and excretion. Safety and handling precautions are essential, as with any chemical, particularly in laboratory settings. Overall, 4-Thiazolemethanamine, 2-(phenylmethyl)-, hydrochloride (1:2) represents a compound of interest in medicinal chemistry, warranting further investigation into its therapeutic potential and mechanisms of action.
Formula:C11H13ClN2S
InChI:InChI=1S/C11H12N2S.2ClH/c12-7-10-8-14-11(13-10)6-9-4-2-1-3-5-9;;/h1-5,8H,6-7,12H2;2*1H
InChI key:InChIKey=PLWCRYKXGKCNKF-UHFFFAOYSA-N
SMILES:C(C1=NC(CN)=CS1)C2=CC=CC=C2.Cl
Synonyms:- 4-Thiazolemethanamine, 2-(phenylmethyl)-, hydrochloride (1:2)
- (2-Benzylthiazol-4-yl)methanamine dihydrochloride
- [(2-benzyl-1,3-thiazol-4-yl)methyl]amine dihydrochloride
- C-(2-BENZYL-THIAZOL-4-YL)-METHYLAMINE DIHYDROCHLORIDE
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.