
CAS 1187932-78-0
:Oxazolo[4,5-c]pyridine, 4,5,6,7-tetrahydro-2,5-dimethyl-, hydrochloride (1:1)
Description:
Oxazolo[4,5-c]pyridine, 4,5,6,7-tetrahydro-2,5-dimethyl-, hydrochloride (1:1) is a chemical compound characterized by its bicyclic structure, which incorporates both oxazole and pyridine rings. This compound features a tetrahydro configuration, indicating that it contains a saturated ring system, and the presence of two methyl groups contributes to its overall molecular complexity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceutical contexts. The compound may exhibit biological activity, making it of interest in medicinal chemistry for potential therapeutic uses. Its CAS number, 1187932-78-0, allows for precise identification and retrieval of information regarding its properties, synthesis, and applications in scientific literature. Overall, this compound's unique structural features and solubility profile make it a subject of interest in both research and industrial applications.
Formula:C8H12N2O·ClH
InChI:InChI=1S/C8H12N2O.ClH/c1-6-9-7-5-10(2)4-3-8(7)11-6;/h3-5H2,1-2H3;1H
InChI key:InChIKey=LOAZQGCHFSBUEY-UHFFFAOYSA-N
SMILES:CC=1OC2=C(N1)CN(C)CC2.Cl
Synonyms:- Oxazolo[4,5-c]pyridine, 4,5,6,7-tetrahydro-2,5-dimethyl-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.