CAS 1187932-80-4

1H-Indazole, 3-chloro-1-(4-pyridinylmethyl)-, hydrochloride (1:1)

Description:

1H-Indazole, 3-chloro-1-(4-pyridinylmethyl)-, hydrochloride (1:1) is a chemical compound characterized by its indazole core, which is a five-membered aromatic ring containing two nitrogen atoms. The presence of a chlorine atom at the 3-position and a 4-pyridinylmethyl group at the 1-position contributes to its unique reactivity and potential biological activity. As a hydrochloride salt, it is typically more soluble in water, enhancing its utility in various applications, particularly in pharmaceutical research. This compound may exhibit properties such as antimicrobial, anti-inflammatory, or anticancer activities, making it of interest in medicinal chemistry. Its molecular structure allows for interactions with biological targets, potentially influencing cellular pathways. The compound's stability, solubility, and reactivity can be influenced by the presence of the hydrochloride moiety, which can also affect its pharmacokinetic properties. Overall, 1H-Indazole, 3-chloro-1-(4-pyridinylmethyl)-, hydrochloride (1:1) represents a class of compounds that may hold promise in drug development and therapeutic applications.

Formula: C₁₃H₁₀ClN₃·ClH

InChI: InChI=1S/C13H10ClN3.ClH/c14-13-11-3-1-2-4-12(11)17(16-13)9-10-5-7-15-8-6-10;/h1-8H,9H2;1H

InChI key: InChIKey=KCOCMHLAPBESTF-UHFFFAOYSA-N

SMILES: C(N1C=2C(C(Cl)=N1)=CC=CC2)C=3C=CN=CC3.Cl

Synonyms:

• 1H-Indazole, 3-chloro-1-(4-pyridinylmethyl)-, hydrochloride (1:1)