CymitQuimica logo

CAS 1187932-81-5

:

3-Bromo-5-isoxazoleethanamine

Description:
3-Bromo-5-isoxazoleethanamine is a chemical compound characterized by its unique structure, which includes a bromine atom and an isoxazole ring. The isoxazole moiety contributes to its potential biological activity, as compounds containing this functional group are often investigated for their pharmacological properties. The presence of the ethylamine side chain enhances its solubility and reactivity, making it a candidate for various chemical reactions and applications in medicinal chemistry. The compound's CAS number, 1187932-81-5, allows for its identification in chemical databases and literature. While specific physical properties such as melting point, boiling point, and solubility may vary, compounds of this nature typically exhibit moderate to high polarity due to the presence of nitrogen and bromine atoms. Additionally, the bromine substituent may influence the compound's reactivity and interaction with biological targets. Overall, 3-Bromo-5-isoxazoleethanamine represents a class of compounds that may hold significance in drug discovery and development.
Formula:C5H7BrN2O
InChI:InChI=1S/C5H7BrN2O/c6-5-3-4(1-2-7)9-8-5/h3H,1-2,7H2
InChI key:InChIKey=QEIHHMYEMPGRHM-UHFFFAOYSA-N
SMILES:C(CN)C1=CC(Br)=NO1
Synonyms:
  • 5-Isoxazoleethanamine, 3-bromo-
  • 3-Bromo-5-isoxazoleethanamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.