CAS 1187932-84-8

4-[[(3R)-3-Hydroxy-1-pyrrolidinyl]methyl]benzoic acid

Description:

4-[[(3R)-3-Hydroxy-1-pyrrolidinyl]methyl]benzoic acid, with the CAS number 1187932-84-8, is a chemical compound characterized by its unique structural features. It contains a benzoic acid moiety, which is a carboxylic acid derivative of benzene, and a pyrrolidine ring that is substituted with a hydroxyl group. The presence of the hydroxyl group contributes to its potential solubility in polar solvents and may influence its biological activity. The compound's stereochemistry, indicated by the (3R) configuration, suggests that it has specific spatial arrangements that can affect its interactions with biological targets, making it of interest in medicinal chemistry. Its potential applications may include roles in pharmaceuticals or as a biochemical probe, depending on its biological properties. Overall, this compound exemplifies the complexity of organic molecules, where small changes in structure can lead to significant variations in function and reactivity.

Formula: C₁₂H₁₅NO₃

InChI: InChI=1S/C12H15NO3/c14-11-5-6-13(8-11)7-9-1-3-10(4-2-9)12(15)16/h1-4,11,14H,5-8H2,(H,15,16)/t11-/m1/s1

InChI key: InChIKey=CLRWLJGVBPGIRW-LLVKDONJSA-N

SMILES: C(C1=CC=C(C(O)=O)C=C1)N2C[C@H](O)CC2

Synonyms:

• Benzoic acid, 4-[[(3R)-3-hydroxy-1-pyrrolidinyl]methyl]-
• 4-[[(3R)-3-Hydroxy-1-pyrrolidinyl]methyl]benzoic acid

(R)-4-((3-Hydroxypyrrolidin-1-yl)methyl)benzoic acid

CAS: 1187932-84-8

Formula: C₁₂H₁₅NO₃

Molecular weight: 221.2524

Ref: IN-DA008X9X