CAS 1187932-91-7

(αR)-α-(1-Methylethyl)-4-pyridinemethanamine

Description:

(αR)-α-(1-Methylethyl)-4-pyridinemethanamine, also known by its CAS number 1187932-91-7, is a chemical compound characterized by its pyridine ring and an amine functional group. This substance features a chiral center, which contributes to its stereochemistry, specifically the (αR) configuration. The presence of the isopropyl group (1-methylethyl) attached to the alpha carbon enhances its hydrophobic properties, potentially influencing its biological activity and solubility in organic solvents. The pyridine moiety provides basicity due to the nitrogen atom, which can participate in hydrogen bonding and coordination with metal ions. This compound may exhibit pharmacological properties, making it of interest in medicinal chemistry. Its structural characteristics suggest potential applications in drug development, particularly in targeting specific receptors or enzymes. As with many amines, it may also be sensitive to oxidation and can form salts with acids, which can affect its stability and reactivity. Overall, the unique combination of functional groups and stereochemistry makes this compound a subject of interest in various chemical and biological studies.

Formula: C₉H₁₄N₂

InChI: InChI=1S/C9H14N2/c1-7(2)9(10)8-3-5-11-6-4-8/h3-7,9H,10H2,1-2H3/t9-/m1/s1

InChI key: InChIKey=CVIUCMADIABJJL-SECBINFHSA-N

SMILES: [C@H](C(C)C)(N)C=1C=CN=CC1

Synonyms:

• 4-Pyridinemethanamine, α-(1-methylethyl)-, (αR)-
• (αR)-α-(1-Methylethyl)-4-pyridinemethanamine