
CAS 1187932-94-0
:1,2,4-Triazolo[4,3-a]pyrazine, 5,6,7,8-tetrahydro-, ethanedioate (1:1)
Description:
1,2,4-Triazolo[4,3-a]pyrazine, 5,6,7,8-tetrahydro-, ethanedioate (1:1) is a heterocyclic compound characterized by its complex bicyclic structure, which incorporates both triazole and pyrazine moieties. This compound typically exhibits a range of biological activities, making it of interest in pharmaceutical research. The presence of the ethanedioate moiety suggests that it may form salts or complexes, influencing its solubility and stability. The tetrahydro configuration indicates that the compound has undergone partial hydrogenation, which can affect its reactivity and interaction with biological targets. Generally, compounds of this nature are studied for their potential applications in drug development, particularly in areas such as antimicrobial or anticancer therapies. The specific properties, such as melting point, solubility, and spectral characteristics, would depend on the purity and specific conditions under which the compound is analyzed. Overall, 1,2,4-Triazolo[4,3-a]pyrazine derivatives are valuable in medicinal chemistry due to their diverse pharmacological profiles.
Formula:C5H8N4·C2H2O4
InChI:InChI=1S/C5H8N4.C2H2O4/c1-2-9-4-7-8-5(9)3-6-1;3-1(4)2(5)6/h4,6H,1-3H2;(H,3,4)(H,5,6)
InChI key:InChIKey=FWXINHKXTALUDV-UHFFFAOYSA-N
SMILES:C=12N(C=NN1)CCNC2.C(C(O)=O)(O)=O
Synonyms:- 1,2,4-Triazolo[4,3-a]pyrazine, 5,6,7,8-tetrahydro-, ethanedioate (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.