
CAS 1187933-02-3
:Benzenesulfonamide, 2-nitro-N-3-pyrrolidinyl-, hydrochloride (1:1)
Description:
Benzenesulfonamide, 2-nitro-N-3-pyrrolidinyl-, hydrochloride (1:1) is a chemical compound characterized by its sulfonamide functional group, which is known for its antibacterial properties. The presence of a nitro group and a pyrrolidine moiety contributes to its potential biological activity, possibly influencing its pharmacological profile. As a hydrochloride salt, it is typically more soluble in water than its free base form, enhancing its utility in various applications, including medicinal chemistry. The compound may exhibit properties such as moderate stability under standard conditions, but it is sensitive to light and moisture, necessitating careful storage. Its molecular structure suggests potential interactions with biological targets, making it of interest in drug development. Additionally, the compound's synthesis and characterization would involve standard organic chemistry techniques, including purification methods like recrystallization or chromatography. Overall, this compound's unique structural features and properties position it as a candidate for further research in therapeutic applications.
Formula:C10H13N3O4S·ClH
InChI:InChI=1S/C10H13N3O4S.ClH/c14-13(15)9-3-1-2-4-10(9)18(16,17)12-8-5-6-11-7-8;/h1-4,8,11-12H,5-7H2;1H
InChI key:InChIKey=FMPPNFHXAFANMR-UHFFFAOYSA-N
SMILES:S(NC1CCNC1)(=O)(=O)C2=C(N(=O)=O)C=CC=C2.Cl
Synonyms:- Benzenesulfonamide, 2-nitro-N-3-pyrrolidinyl-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.