
CAS 1187933-11-4
:2-(3-Bromophenyl)-4-oxazolecarboxylic acid
Description:
2-(3-Bromophenyl)-4-oxazolecarboxylic acid is a chemical compound characterized by its oxazole ring, which is a five-membered heterocyclic structure containing both nitrogen and oxygen. The presence of a bromophenyl group indicates that a bromine atom is substituted on the phenyl ring at the meta position relative to the carboxylic acid functional group. This compound typically exhibits properties such as moderate solubility in organic solvents and potential reactivity due to the carboxylic acid group, which can participate in various chemical reactions, including esterification and amidation. The oxazole moiety may contribute to biological activity, making this compound of interest in medicinal chemistry and drug development. Additionally, the bromine substituent can influence the compound's electronic properties and reactivity, potentially enhancing its pharmacological profile. Overall, 2-(3-Bromophenyl)-4-oxazolecarboxylic acid is a versatile compound with applications in research and development, particularly in the fields of organic synthesis and pharmaceuticals.
Formula:C10H6BrNO3
InChI:InChI=1S/C10H6BrNO3/c11-7-3-1-2-6(4-7)9-12-8(5-15-9)10(13)14/h1-5H,(H,13,14)
InChI key:InChIKey=RGLIXBNOGPILKO-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1N=C(OC1)C2=CC(Br)=CC=C2
Synonyms:- 2-(3-Bromophenyl)-1,3-oxazole-4-carboxylic acid
- 2-(3-Bromophenyl)-4-oxazolecarboxylic acid
- 4-Oxazolecarboxylic acid, 2-(3-bromophenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.