CAS 1187933-19-2

3-Pyridinecarboxaldehyde, 4-amino-, 2,2,2-trifluoroacetate (1:1)

Description:

3-Pyridinecarboxaldehyde, 4-amino-, 2,2,2-trifluoroacetate (1:1) is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. The presence of the carboxaldehyde functional group indicates that it has an aldehyde moiety, contributing to its reactivity and potential applications in organic synthesis. The amino group at the 4-position of the pyridine ring enhances its nucleophilicity, making it useful in various chemical reactions, including coupling reactions and as a building block in pharmaceuticals. The trifluoroacetate moiety introduces significant electronegativity due to the three fluorine atoms, which can influence the compound's solubility and reactivity. This compound may exhibit unique properties such as increased lipophilicity and altered acidity compared to its non-fluorinated counterparts. Overall, its structural features suggest potential applications in medicinal chemistry and material science, although specific applications would depend on further research and characterization.

Formula: C₆H₆N₂O·C₂HF₃O₂

InChI: InChI=1S/C6H6N2O.C2HF3O2/c7-6-1-2-8-3-5(6)4-9;3-2(4,5)1(6)7/h1-4H,(H2,7,8);(H,6,7)

InChI key: InChIKey=STBDXCULUSZTMT-UHFFFAOYSA-N

SMILES: C(=O)C=1C(N)=CC=NC1.C(C(O)=O)(F)(F)F

Synonyms:

• 3-Pyridinecarboxaldehyde, 4-amino-, 2,2,2-trifluoroacetate (1:1)

4-Amino-Pyridine-3-Carbaldehyde Trifluoroacetate

CAS: 1187933-19-2

Formula: C₈H₇F₃N₂O₃

Purity: 95%

Molecular weight: 236.1480

Ref: IN-DA01DTRN