
CAS 1187933-26-1
:8-Quinolinemethanamine, N-methyl-, hydrochloride (1:2)
Description:
8-Quinolinemethanamine, N-methyl-, hydrochloride (1:2) is a chemical compound characterized by its structure, which includes a quinoline ring and a methylated amine group. This compound typically appears as a hydrochloride salt, indicating it is soluble in water and may exhibit ionic properties. It is often used in various chemical and pharmaceutical applications due to its potential biological activity, particularly in medicinal chemistry. The presence of the quinoline moiety suggests possible interactions with biological targets, making it of interest in drug development. The hydrochloride form enhances its stability and solubility, facilitating its use in formulations. As with many amines, it may exhibit basic properties, and its behavior in solution can be influenced by pH. Safety and handling precautions are essential, as with any chemical substance, to mitigate risks associated with exposure. Overall, this compound represents a class of molecules that can be explored for their therapeutic potential and chemical reactivity.
Formula:C11H12N2·2ClH
InChI:InChI=1S/C11H12N2.2ClH/c1-12-8-10-5-2-4-9-6-3-7-13-11(9)10;;/h2-7,12H,8H2,1H3;2*1H
InChI key:InChIKey=YXJCYDKXQDQYSM-UHFFFAOYSA-N
SMILES:C(NC)C=1C2=C(C=CC1)C=CC=N2.Cl
Synonyms:- 8-Quinolinemethanamine, N-methyl-, hydrochloride (1:2)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.