CAS 1187933-31-8
:1,1-Dimethylethyl (3R)-3-amino-3,4-dihydro-1(2H)-quinolinecarboxylate
Description:
1,1-Dimethylethyl (3R)-3-amino-3,4-dihydro-1(2H)-quinolinecarboxylate, identified by its CAS number 1187933-31-8, is a chemical compound that features a quinoline structure, which is a bicyclic aromatic compound known for its diverse biological activities. This substance contains an amino group and a carboxylate functional group, contributing to its potential reactivity and solubility in various solvents. The presence of the dimethyl group indicates steric hindrance, which may influence its interaction with biological targets. The (3R) configuration suggests that it has specific stereochemical properties, which can be crucial for its biological activity and pharmacological profile. Compounds of this nature are often investigated for their potential therapeutic applications, particularly in medicinal chemistry, due to their ability to interact with various biological pathways. Overall, the characteristics of this compound suggest it may have significant implications in drug development and research.
Formula:C14H20N2O2
InChI:InChI=1S/C14H20N2O2/c1-14(2,3)18-13(17)16-9-11(15)8-10-6-4-5-7-12(10)16/h4-7,11H,8-9,15H2,1-3H3/t11-/m1/s1
InChI key:InChIKey=MVZZYBHLXOUNIT-LLVKDONJSA-N
SMILES:C(OC(C)(C)C)(=O)N1C=2C(C[C@@H](N)C1)=CC=CC2
Synonyms:- 1,1-Dimethylethyl (3R)-3-amino-3,4-dihydro-1(2H)-quinolinecarboxylate
- 1(2H)-Quinolinecarboxylic acid, 3-amino-3,4-dihydro-, 1,1-dimethylethyl ester, (3R)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.