CymitQuimica logo

CAS 1187933-39-6

:

9H-Fluoren-9-ylmethyl 3-(aminomethyl)-3,4-dihydro-2(1H)-isoquinolinecarboxylate

Description:
9H-Fluoren-9-ylmethyl 3-(aminomethyl)-3,4-dihydro-2(1H)-isoquinolinecarboxylate is a chemical compound characterized by its complex structure, which includes a fluorenylmethyl group and an isoquinoline derivative. This compound typically exhibits properties associated with both aromatic and aliphatic systems due to its fused ring structure. It may display moderate to high lipophilicity, influencing its solubility in organic solvents and potential bioactivity. The presence of an amino group suggests potential for hydrogen bonding and reactivity, which could be relevant in medicinal chemistry applications. Additionally, the isoquinoline moiety is often associated with various biological activities, making this compound of interest in drug development. Its molecular interactions, stability, and reactivity can be influenced by factors such as pH and the presence of other functional groups. Overall, this compound's unique structural features may contribute to its potential applications in pharmaceuticals or as a research tool in organic synthesis.
Formula:C25H24N2O2
InChI:InChI=1S/C25H24N2O2/c26-14-19-13-17-7-1-2-8-18(17)15-27(19)25(28)29-16-24-22-11-5-3-9-20(22)21-10-4-6-12-23(21)24/h1-12,19,24H,13-16,26H2
InChI key:InChIKey=GHBGSKWVDCQDSR-UHFFFAOYSA-N
SMILES:C(OC(=O)N1C(CN)CC=2C(C1)=CC=CC2)C3C=4C(C=5C3=CC=CC5)=CC=CC4
Synonyms:
  • 9H-Fluoren-9-ylmethyl 3-(aminomethyl)-3,4-dihydro-2(1H)-isoquinolinecarboxylate
  • 2(1H)-Isoquinolinecarboxylic acid, 3-(aminomethyl)-3,4-dihydro-, 9H-fluoren-9-ylmethyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.