CymitQuimica logo

CAS 1187933-43-2

:

7-Fluoro-1,2,3,4-tetrahydro-4,4-dimethylquinoline

Description:
7-Fluoro-1,2,3,4-tetrahydro-4,4-dimethylquinoline is a chemical compound characterized by its unique bicyclic structure, which includes a quinoline moiety. The presence of a fluorine atom at the 7-position contributes to its potential reactivity and biological activity. This compound features a tetrahydro configuration, indicating that it contains a saturated ring system, which can influence its physical properties such as solubility and stability. The dimethyl groups at the 4-position enhance steric hindrance, potentially affecting its interaction with biological targets. This compound may exhibit interesting pharmacological properties, making it of interest in medicinal chemistry. Its molecular structure suggests potential applications in drug development, particularly in areas targeting neurological or infectious diseases. The CAS number 1187933-43-2 serves as a unique identifier for this substance, facilitating its identification in chemical databases and literature. Overall, 7-Fluoro-1,2,3,4-tetrahydro-4,4-dimethylquinoline represents a compound with significant potential for research and application in various fields of chemistry and pharmacology.
Formula:C11H14FN
InChI:InChI=1S/C11H14FN/c1-11(2)5-6-13-10-7-8(12)3-4-9(10)11/h3-4,7,13H,5-6H2,1-2H3
InChI key:InChIKey=KTAVEICIDOECMM-UHFFFAOYSA-N
SMILES:CC1(C)C=2C(=CC(F)=CC2)NCC1
Synonyms:
  • Quinoline, 7-fluoro-1,2,3,4-tetrahydro-4,4-dimethyl-
  • 7-Fluoro-4,4-dimethyl-1,2,3,4-tetrahydroquinoline
  • 7-Fluoro-1,2,3,4-tetrahydro-4,4-dimethylquinoline
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.