
CAS 1187933-44-3
:1,7-Naphthyridine, 1,2,3,4-tetrahydro-, hydrochloride (1:2)
Description:
1,7-Naphthyridine, 1,2,3,4-tetrahydro-, hydrochloride (1:2) is a chemical compound characterized by its bicyclic structure, which includes a naphthyridine moiety. This compound features a saturated tetrahydro form, indicating the presence of four hydrogen atoms added to the naphthyridine ring system, resulting in a more stable, less reactive structure compared to its unsaturated counterparts. The hydrochloride designation signifies that the compound is in its salt form, typically enhancing its solubility in water and making it more suitable for various applications, including pharmaceutical formulations. The presence of the hydrochloride also suggests potential uses in medicinal chemistry, where such compounds may exhibit biological activity. As with many nitrogen-containing heterocycles, this compound may participate in various chemical reactions, including nucleophilic substitutions and coordination with metal ions. Its specific properties, such as melting point, boiling point, and solubility, would depend on the conditions and purity of the sample. Overall, 1,7-Naphthyridine, 1,2,3,4-tetrahydro-, hydrochloride (1:2) represents a versatile structure in organic and medicinal chemistry.
Formula:C8H10N2·2ClH
InChI:InChI=1S/C8H10N2.2ClH/c1-2-7-3-5-9-6-8(7)10-4-1;;/h3,5-6,10H,1-2,4H2;2*1H
InChI key:InChIKey=BVGQERVDQXKCCL-UHFFFAOYSA-N
SMILES:C=12C(=CN=CC1)NCCC2.Cl
Synonyms:- 1,7-Naphthyridine, 1,2,3,4-tetrahydro-, hydrochloride (1:2)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
1,2,3,4-Tetrahydro-[1,7]naphthyridine dihydrochloride
CAS:Formula:C8H12Cl2N2Purity:95%Color and Shape:SolidMolecular weight:207.10031,2,3,4-Tetrahydro-[1,7]naphthyridine dihydrochloride
CAS:1,2,3,4-Tetrahydro-[1,7]naphthyridine dihydrochloride is a fine chemical that is used as a research compound. It is an intermediate in the synthesis of other compounds and has been shown to be a useful building block for a number of reactions. It can be used as a reaction component for complex compounds and scaffolds for drug discovery or synthesis. 1,2,3,4-Tetrahydro-[1,7]naphthyridine dihydrochloride is also a useful building block for the syntheses of many organic compounds. This chemical has high purity and quality and is suitable as reagent in laboratory research.
Formula:C8H12Cl2N2Purity:Min. 95%Color and Shape:PowderMolecular weight:207.1 g/mol


