CAS 1187933-49-8

Methyl 1,2,3,4-tetrahydro-4,4-dimethyl-6-quinolinecarboxylate

Description:

Methyl 1,2,3,4-tetrahydro-4,4-dimethyl-6-quinolinecarboxylate is a chemical compound characterized by its unique structure, which includes a quinoline ring fused with a tetrahydro moiety. This compound features a carboxylate functional group, which contributes to its reactivity and potential applications in organic synthesis. The presence of multiple methyl groups enhances its hydrophobic characteristics, influencing its solubility and interaction with biological systems. Typically, compounds of this nature may exhibit interesting pharmacological properties, making them of interest in medicinal chemistry. The molecular structure suggests potential for various chemical reactions, including esterification and nucleophilic substitutions. Additionally, the compound's CAS number, 1187933-49-8, allows for precise identification and retrieval of information in chemical databases. Overall, Methyl 1,2,3,4-tetrahydro-4,4-dimethyl-6-quinolinecarboxylate represents a class of compounds that may have significant implications in research and development within the fields of pharmaceuticals and organic chemistry.

Formula: C₁₃H₁₇NO₂

InChI: InChI=1S/C13H17NO2/c1-13(2)6-7-14-11-5-4-9(8-10(11)13)12(15)16-3/h4-5,8,14H,6-7H2,1-3H3

InChI key: InChIKey=QJUNRQREKZOVOG-UHFFFAOYSA-N

SMILES: CC1(C)C=2C(=CC=C(C(OC)=O)C2)NCC1

Synonyms:

• Methyl 1,2,3,4-tetrahydro-4,4-dimethyl-6-quinolinecarboxylate
• 6-Quinolinecarboxylic acid, 1,2,3,4-tetrahydro-4,4-dimethyl-, methyl ester