
CAS 1187933-51-2
:4-Oxazolemethanamine, 2-(4-fluorophenyl)-, hydrochloride (1:1)
Description:
4-Oxazolemethanamine, 2-(4-fluorophenyl)-, hydrochloride (1:1) is a chemical compound characterized by its oxazole ring structure, which contributes to its heterocyclic properties. The presence of a 4-fluorophenyl group indicates that the compound has a fluorine atom substituted on the phenyl ring, potentially influencing its reactivity and biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which is advantageous for various applications, including pharmaceutical formulations. The compound may exhibit specific pharmacological properties due to its structural features, making it of interest in medicinal chemistry. Its molecular interactions, stability, and potential uses in drug development would depend on the functional groups present and their spatial arrangement. Safety and handling considerations are essential, as with any chemical substance, particularly in laboratory or industrial settings. Further studies would be necessary to fully elucidate its properties, including its mechanism of action, toxicity, and potential therapeutic applications.
Formula:C10H9FN2O·ClH
InChI:InChI=1S/C10H9FN2O.ClH/c11-8-3-1-7(2-4-8)10-13-9(5-12)6-14-10;/h1-4,6H,5,12H2;1H
InChI key:InChIKey=SPSCBBJUGQDXCX-UHFFFAOYSA-N
SMILES:C(N)C=1N=C(OC1)C2=CC=C(F)C=C2.Cl
Synonyms:- 4-Oxazolemethanamine, 2-(4-fluorophenyl)-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
(2-(4-Fluorophenyl)oxazol-4-yl)methanamine hydrochloride
CAS:Formula:C10H10ClFN2OMolecular weight:228.6506[2-(4-Fluorophenyl)-1,3-oxazol-4-yl]methanamine hydrochloride
CAS:[2-(4-Fluorophenyl)-1,3-oxazol-4-yl]methanamine hydrochloride
Molecular weight:228.6506g/mol


