CymitQuimica logo

CAS 1187968-61-1

:

6-Bromo-4,4-difluoro-3,4-dihydro-2H-1-benzopyran

Description:
6-Bromo-4,4-difluoro-3,4-dihydro-2H-1-benzopyran is a chemical compound characterized by its unique structure, which includes a benzopyran core with bromine and difluoro substituents. This compound features a fused bicyclic system, contributing to its potential reactivity and stability. The presence of bromine introduces a halogen that can participate in various chemical reactions, such as nucleophilic substitutions or coupling reactions. The difluoro groups enhance the compound's lipophilicity and may influence its biological activity, making it of interest in medicinal chemistry. Additionally, the dihydro configuration indicates that the compound may exist in a partially saturated form, which can affect its physical properties, such as boiling and melting points. The compound's unique characteristics may render it useful in the development of pharmaceuticals or agrochemicals, where specific interactions with biological targets are desired. Overall, 6-Bromo-4,4-difluoro-3,4-dihydro-2H-1-benzopyran exemplifies the complexity and diversity of organic compounds in chemical research.
Formula:C9H7BrF2O
InChI:InChI=1S/C9H7BrF2O/c10-6-1-2-8-7(5-6)9(11,12)3-4-13-8/h1-2,5H,3-4H2
InChI key:InChIKey=UJUNRVPKJVWMBB-UHFFFAOYSA-N
SMILES:FC1(F)C=2C(OCC1)=CC=C(Br)C2
Synonyms:
  • 6-Bromo-4,4-difluorochroman
  • 2H-1-Benzopyran, 6-bromo-4,4-difluoro-3,4-dihydro-
  • 6-Bromo-4,4-difluoro-3,4-dihydro-2H-1-benzopyran
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.