
CAS 1188147-10-5
:7-Chloro-2-benzothiazolecarbonitrile
Description:
7-Chloro-2-benzothiazolecarbonitrile is a chemical compound characterized by its unique structure, which includes a benzothiazole moiety and a cyano group. This compound typically exhibits a solid state at room temperature and is known for its potential applications in pharmaceuticals and agrochemicals due to its biological activity. The presence of the chlorine atom and the cyano group contributes to its reactivity and may influence its solubility in various solvents. It is generally considered to have moderate to low toxicity, but specific safety data should be consulted for handling and usage. The compound's molecular structure allows for interactions with biological targets, making it of interest in medicinal chemistry. Additionally, its stability under standard conditions makes it suitable for various synthetic applications. As with any chemical substance, proper safety protocols should be followed when handling 7-Chloro-2-benzothiazolecarbonitrile to mitigate any potential risks associated with its use.
Formula:C8H3ClN2S
InChI:InChI=1S/C8H3ClN2S/c9-5-2-1-3-6-8(5)12-7(4-10)11-6/h1-3H
InChI key:InChIKey=CEJBBOFZPWCAHI-UHFFFAOYSA-N
SMILES:ClC1=C2C(N=C(C#N)S2)=CC=C1
Synonyms:- 7-Chloro-2-benzothiazolecarbonitrile
- 2-Benzothiazolecarbonitrile, 7-chloro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
