CymitQuimica logo

CAS 118824-96-7

:

4'-benzyloxy-2'-methoxy-3'-methyl-acetophenone

Description:
4'-Benzyloxy-2'-methoxy-3'-methyl-acetophenone, with the CAS number 118824-96-7, is an organic compound that belongs to the class of acetophenones. This substance features a ketone functional group, characterized by the presence of a carbonyl group (C=O) adjacent to an aromatic ring. Its structure includes a methoxy group (-OCH3) and a benzyloxy group (-O-Ph) attached to the aromatic system, contributing to its chemical reactivity and potential applications in organic synthesis. The methyl group (-CH3) at the 3' position of the aromatic ring influences its steric and electronic properties, which can affect its reactivity and interactions with other molecules. This compound may exhibit properties such as moderate solubility in organic solvents and potential biological activity, making it of interest in fields like medicinal chemistry and materials science. As with many organic compounds, its stability and reactivity can be influenced by environmental factors such as temperature and pH.
Formula:C17H18O3
InChI:InChI=1/C17H18O3/c1-12-16(20-11-14-7-5-4-6-8-14)10-9-15(13(2)18)17(12)19-3/h4-10H,11H2,1-3H3
SMILES:Cc1c(ccc(C(=O)C)c1OC)OCc1ccccc1
Synonyms:
  • 4-Benzyloxy-2-methoxy-3-methylacetophenone
  • 1-[4-(Benzyloxy)-2-Methoxy-3-Methylphenyl]Ethanone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.