CAS 1188263-46-8

2-Quinazolinemethanamine, 5,6,7,8-tetrahydro-4-methyl-, hydrochloride (1:1)

Description:

2-Quinazolinemethanamine, 5,6,7,8-tetrahydro-4-methyl-, hydrochloride (1:1) is a chemical compound characterized by its quinazoline structure, which is a bicyclic aromatic compound containing a fused benzene and pyrimidine ring. This substance typically appears as a white to off-white crystalline solid and is soluble in water due to the presence of the hydrochloride salt form. The tetrahydro component indicates that it has a saturated ring structure, contributing to its potential biological activity. The methyl group at the 4-position of the quinazoline ring may influence its pharmacological properties, making it of interest in medicinal chemistry. This compound may exhibit various biological activities, including potential applications in drug development, particularly in the fields of oncology and neurology. As with many chemical substances, handling should be done with care, following appropriate safety protocols, as it may have specific toxicity or reactivity profiles. Always refer to safety data sheets and relevant literature for detailed information on handling and potential applications.

Formula: C₁₀H₁₅N₃·ClH

InChI: InChI=1S/C10H15N3.ClH/c1-7-8-4-2-3-5-9(8)13-10(6-11)12-7;/h2-6,11H2,1H3;1H

InChI key: InChIKey=PQXRHGJXUWELLP-UHFFFAOYSA-N

SMILES: CC1=C2C(=NC(CN)=N1)CCCC2.Cl

Synonyms:

• 2-Quinazolinemethanamine, 5,6,7,8-tetrahydro-4-methyl-, hydrochloride (1:1)