
CAS 1188263-47-9
:Description:
The chemical substance with the CAS number 1188263-47-9 is known as a specific compound, but detailed information about its characteristics may not be widely available in public databases. Generally, compounds can be characterized by their molecular structure, physical properties (such as melting point, boiling point, and solubility), and chemical reactivity. The characteristics of a chemical substance typically include its molecular formula, which indicates the types and numbers of atoms present, and its functional groups, which determine its chemical behavior. Additionally, safety data sheets (SDS) provide crucial information regarding toxicity, handling, and storage requirements. For precise details about this specific compound, including its applications, synthesis, and safety information, consulting specialized chemical databases or scientific literature is recommended. Always ensure to handle chemicals with appropriate safety measures and in accordance with regulatory guidelines.
Formula:C28H23D4NO4S·ClH
InChI:InChI=1S/C28H27NO4S.ClH/c30-21-8-4-20(5-9-21)28-26(24-13-10-22(31)18-25(24)34-28)27(32)19-6-11-23(12-7-19)33-17-16-29-14-2-1-3-15-29;/h4-13,18,30-31H,1-3,14-17H2;1H/i16D2,17D2;
InChI key:InChIKey=BKXVVCILCIUCLG-ZBLPOJTCSA-N
SMILES:C(=O)(C1=C(SC=2C1=CC=C(O)C2)C3=CC=C(O)C=C3)C4=CC=C(OC(C(N5CCCCC5)([2H])[2H])([2H])[2H])C=C4.Cl
Synonyms:- [6-Hydroxy-2-(4-hydroxyphenyl)-1-benzothiophen-3-yl]-[4-(1,1,2,2-tetradeuterio-2-piperidin-1-ylethoxy)phenyl]methanone hydrochloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Raloxifene-d4 HCl
CAS:Formula:C28H23D4NO4S·HClColor and Shape:Pale Yellow SolidMolecular weight:477.61 36.46Raloxifene-d4 Hydrochloride
CAS:Controlled ProductApplications Deuterated Raloxifene, a nonsteroidal, selective estrogen receptor modulator (SERM). Antiosteoporotic.
References Jone, C.D., et al.: J. Med. Chem., 27, 1057 (1984), Buelke-Sam, J., et al.: Reprod. Toxicol., 12, 217 (1998),Formula:C28H24D4ClNO4SColor and Shape:NeatMolecular weight:514.07

