
CAS 1188263-65-1
:1-Piperidinecarboxylic acid, 4-(methylamino)-, 1,1-dimethylethyl ester, hydrochloride (1:1)
Description:
1-Piperidinecarboxylic acid, 4-(methylamino)-, 1,1-dimethylethyl ester, hydrochloride (1:1), with CAS number 1188263-65-1, is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated heterocycle containing one nitrogen atom. This compound features a carboxylic acid moiety that is esterified with a tert-butyl group, enhancing its lipophilicity and potentially influencing its pharmacokinetic properties. The presence of a methylamino group at the 4-position of the piperidine ring suggests that it may exhibit basic properties, allowing it to form salts, such as the hydrochloride form. This hydrochloride salt form typically increases the solubility of the compound in aqueous solutions, making it more suitable for various applications, including pharmaceutical formulations. The compound's structure indicates potential biological activity, which may be explored in medicinal chemistry contexts. However, specific biological effects, toxicity, and therapeutic uses would require further investigation through empirical studies and literature review.
Formula:C11H22N2O2·ClH
InChI:InChI=1S/C11H22N2O2.ClH/c1-11(2,3)15-10(14)13-7-5-9(12-4)6-8-13;/h9,12H,5-8H2,1-4H3;1H
InChI key:InChIKey=RUGNSNJVKBMSGK-UHFFFAOYSA-N
SMILES:C(OC(C)(C)C)(=O)N1CCC(NC)CC1.Cl
Synonyms:- 1-Piperidinecarboxylic acid, 4-(methylamino)-, 1,1-dimethylethyl ester, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
tert-Butyl 4-(methylamino)piperidine-1-carboxylate hydrochloride
CAS:Formula:C11H23ClN2O2Molecular weight:250.7655
