CAS 1188263-66-2

1,3,4-Oxadiazole-2-carboxylic acid, potassium salt (1:1)

Description:

1,3,4-Oxadiazole-2-carboxylic acid, potassium salt (1:1) is a chemical compound characterized by its oxadiazole ring structure, which consists of a five-membered heterocyclic framework containing two nitrogen atoms and three carbon atoms. This compound features a carboxylic acid functional group, which contributes to its acidic properties, and the potassium salt form enhances its solubility in water. The presence of the potassium ion can influence the compound's stability and reactivity, making it useful in various applications, including pharmaceuticals and agrochemicals. The oxadiazole moiety is known for its biological activity, often exhibiting antimicrobial and anti-inflammatory properties. Additionally, the compound may serve as a building block in organic synthesis, facilitating the development of more complex molecules. Its unique structural features and functional groups make it a subject of interest in medicinal chemistry and materials science. As with any chemical substance, proper handling and safety precautions should be observed due to potential hazards associated with its use.

Formula: C₃H₂N₂O₃·K

InChI: InChI=1S/C3H2N2O3.K/c6-3(7)2-5-4-1-8-2;/h1H,(H,6,7);

InChI key: InChIKey=ORQJBXFMILDJMS-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=NN=CO1.[K]

Synonyms:

• 1,3,4-Oxadiazole-2-carboxylic acid, potassium salt (1:1)

Potassium 1,3,4-oxadiazole-2-carboxylate

CAS: 1188263-66-2

Potassium 1,3,4-oxadiazole-2-carboxylate

Purity: 97%

Molecular weight: 152.15g/mol

Ref: 54-OR1054417