
CAS 1188263-74-2
:2-Methyl-2-propanyl 2-(aminomethyl)-1-pyrrolidinecarboxylatehydrochloride
Description:
2-Methyl-2-propanyl 2-(aminomethyl)-1-pyrrolidinecarboxylate hydrochloride, identified by its CAS number 1188263-74-2, is a chemical compound that belongs to the class of pyrrolidine derivatives. This substance typically features a pyrrolidine ring, which is a five-membered nitrogen-containing heterocycle, and is substituted with an aminomethyl group and a carboxylate moiety. The presence of the hydrochloride indicates that it is in its salt form, which often enhances solubility in water and stability. The compound may exhibit biological activity, potentially acting as a ligand or modulator in various biochemical pathways. Its structural characteristics suggest it could be of interest in medicinal chemistry, particularly in the development of pharmaceuticals. As with many organic compounds, its physical properties, such as melting point, solubility, and reactivity, would depend on the specific conditions and the presence of other functional groups. Safety data and handling precautions should be consulted, as with any chemical substance, to ensure proper laboratory practices.
Formula:C10H21ClN2O2
InChI:InChI=1S/C10H20N2O2.ClH/c1-10(2,3)14-9(13)12-6-4-5-8(12)7-11;/h8H,4-7,11H2,1-3H3;1H
InChI key:InChIKey=MQYQQPSDLQAGFQ-UHFFFAOYSA-N
SMILES:C(OC(C)(C)C)(=O)N1C(CN)CCC1.Cl
Synonyms:- 1-Pyrrolidinecarboxylic acid, 2-(aminomethyl)-, 1,1-dimethylethyl ester, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
tert-Butyl 2-(aminomethyl)pyrrolidine-1-carboxylate hydrochloride
CAS:Formula:C10H21ClN2O2Molecular weight:236.7389
