CAS 1188264-05-2

Benzonitrile, 3-(1-aminoethyl)-, hydrochloride (1:1)

Description:

Benzonitrile, 3-(1-aminoethyl)-, hydrochloride (1:1) is a chemical compound characterized by its structure, which includes a benzonitrile moiety and an aminoethyl group. This compound typically appears as a white to off-white solid and is soluble in water due to the presence of the hydrochloride salt form. The aminoethyl group contributes to its basicity, allowing it to form salts with acids, such as hydrochloric acid, which enhances its solubility and stability. The presence of the nitrile functional group (-C≡N) imparts unique reactivity, making it useful in various synthetic applications, including organic synthesis and pharmaceutical development. Its molecular interactions may involve hydrogen bonding due to the amino group, influencing its behavior in biological systems. As with many chemical substances, safety precautions should be observed when handling this compound, as it may pose health risks if ingested or inhaled. Overall, this compound's characteristics make it of interest in both research and industrial applications.

Formula: C₉H₁₀N₂·ClH

InChI: InChI=1S/C9H10N2.ClH/c1-7(11)9-4-2-3-8(5-9)6-10;/h2-5,7H,11H2,1H3;1H

InChI key: InChIKey=UMKDPZGKJZQZAY-UHFFFAOYSA-N

SMILES: C(C)(N)C1=CC(C#N)=CC=C1.Cl

Synonyms:

• Benzonitrile, 3-(1-aminoethyl)-, hydrochloride (1:1)
• 3-(1-Aminoethyl)benzonitrile hydrochloride

3-(1-AMINOETHYL)BENZONITRILE-HCl

CAS: 1188264-05-2

Formula: C₉H₁₁ClN₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 182.6500

Ref: IN-DA007PK9

3-(1-Aminoethyl)benzonitrile hydrochloride

CAS: 1188264-05-2

3-(1-Aminoethyl)benzonitrile hydrochloride

Purity: 95%

Molecular weight: 182.65g/mol

Ref: 54-OR84056