
CAS 1188264-24-5
:Bicyclo[4.2.0]octa-1,3,5-triene-3-carbonitrile
Description:
Bicyclo[4.2.0]octa-1,3,5-triene-3-carbonitrile is a bicyclic organic compound characterized by its unique bicyclic structure, which consists of two interconnected cyclobutane rings. This compound features a triene system, indicating the presence of three conjugated double bonds, which contributes to its reactivity and potential applications in organic synthesis. The carbonitrile functional group (-C≡N) attached to the bicyclic framework enhances its polarity and can influence its chemical behavior, making it useful in various chemical reactions, including nucleophilic additions and cycloadditions. The compound's structure allows for interesting stereochemical properties and potential applications in materials science and medicinal chemistry. Its relatively complex arrangement may also lead to unique physical properties, such as solubility and melting point, which are influenced by the bicyclic nature and the presence of the carbonitrile group. Overall, Bicyclo[4.2.0]octa-1,3,5-triene-3-carbonitrile is a compound of interest for researchers exploring novel organic materials and synthetic pathways.
Formula:C9H7N
InChI:InChI=1S/C9H7N/c10-6-7-1-2-8-3-4-9(8)5-7/h1-2,5H,3-4H2
InChI key:InChIKey=KACQOXSDJZTHPE-UHFFFAOYSA-N
SMILES:C(#N)C=1C=C2C(CC2)=CC1
Synonyms:- Bicyclo[4.2.0]octa-1,3,5-triene-3-carbonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.