
CAS 1188264-43-8
:3-(2-Thienylmethyl)pyrrolidine
Description:
3-(2-Thienylmethyl)pyrrolidine is a chemical compound characterized by its unique structure, which includes a pyrrolidine ring and a thienylmethyl group. The pyrrolidine moiety is a five-membered saturated nitrogen-containing heterocycle, contributing to the compound's potential biological activity. The thienyl group, derived from thiophene, introduces aromatic characteristics and may influence the compound's solubility and reactivity. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It may exhibit properties such as moderate polarity due to the presence of the nitrogen atom and the sulfur atom in the thienyl group. The compound's potential applications could span various fields, including medicinal chemistry, where it may serve as a scaffold for drug development or as a ligand in coordination chemistry. However, specific data regarding its toxicity, stability, and reactivity would require further investigation through experimental studies and safety assessments.
Formula:C9H13NS
InChI:InChI=1S/C9H13NS/c1-2-9(11-5-1)6-8-3-4-10-7-8/h1-2,5,8,10H,3-4,6-7H2
InChI key:InChIKey=DZBDYMFOWFPTNP-UHFFFAOYSA-N
SMILES:C(C1CCNC1)C2=CC=CS2
Synonyms:- Pyrrolidine, 3-(2-thienylmethyl)-
- 3-(2-Thienylmethyl)pyrrolidine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.