
CAS 1188264-44-9
:3-[(Phenylmethoxy)methyl]-3-oxetanecarboxaldehyde
Description:
3-[(Phenylmethoxy)methyl]-3-oxetanecarboxaldehyde is a chemical compound characterized by its oxetane ring structure, which is a four-membered cyclic ether. This compound features a carboxaldehyde functional group, indicating the presence of a carbonyl group (C=O) adjacent to a hydrogen atom, which contributes to its reactivity and potential applications in organic synthesis. The phenylmethoxy group attached to the oxetane ring enhances its chemical properties, providing opportunities for various substitution reactions. The presence of the phenyl group can also influence the compound's solubility and stability, making it of interest in medicinal chemistry and materials science. Additionally, the compound's unique structure may exhibit specific stereochemical properties, which can be significant in determining its biological activity or interaction with other molecules. Overall, 3-[(Phenylmethoxy)methyl]-3-oxetanecarboxaldehyde is a versatile compound with potential applications in synthetic organic chemistry and pharmaceutical development.
Formula:C12H14O3
InChI:InChI=1S/C12H14O3/c13-7-12(9-15-10-12)8-14-6-11-4-2-1-3-5-11/h1-5,7H,6,8-10H2
InChI key:InChIKey=HAVALIYGOPFYTR-UHFFFAOYSA-N
SMILES:C(OCC1=CC=CC=C1)C2(C=O)COC2
Synonyms:- 3-Oxetanecarboxaldehyde, 3-[(phenylmethoxy)methyl]-
- 3-[(Benzyloxy)methyl]oxetane-3-carbaldehyde
- 3-[(Phenylmethoxy)methyl]-3-oxetanecarboxaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.