CymitQuimica logo

CAS 1188265-40-8

:

1H-Indazol-5-amine, 3-(4-chlorophenyl)-4,5,6,7-tetrahydro-, hydrochloride (1:1)

Description:
1H-Indazol-5-amine, 3-(4-chlorophenyl)-4,5,6,7-tetrahydro-, hydrochloride (1:1) is a chemical compound characterized by its indazole core, which is a five-membered heterocyclic structure containing two nitrogen atoms. The presence of a 4-chlorophenyl group indicates a substitution on the indazole ring, contributing to its potential biological activity. The tetrahydro configuration suggests that the compound has a saturated cyclic structure, which may influence its pharmacokinetic properties. As a hydrochloride salt, it is typically more soluble in water, enhancing its bioavailability for pharmaceutical applications. This compound may exhibit various biological activities, making it of interest in medicinal chemistry and drug development. Its specific interactions and mechanisms of action would depend on its structural features and the presence of functional groups. Safety and handling precautions are essential, as with any chemical substance, particularly in research and industrial settings.
Formula:C13H14ClN3·ClH
InChI:InChI=1S/C13H14ClN3.ClH/c14-9-3-1-8(2-4-9)13-11-7-10(15)5-6-12(11)16-17-13;/h1-4,10H,5-7,15H2,(H,16,17);1H
InChI key:InChIKey=BUVJXQMZRBWIBZ-UHFFFAOYSA-N
SMILES:NC1CC=2C(=NNC2CC1)C3=CC=C(Cl)C=C3.Cl
Synonyms:
  • 1H-Indazol-5-amine, 3-(4-chlorophenyl)-4,5,6,7-tetrahydro-, hydrochloride (1:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.