CymitQuimica logo

CAS 1188265-94-2

:

Ethyl 5-bromo-7-hydroxy-2-benzofurancarboxylate

Description:
Ethyl 5-bromo-7-hydroxy-2-benzofurancarboxylate is a chemical compound characterized by its unique structure, which includes a benzofuran moiety, a bromine substituent, and an ethyl ester functional group. This compound typically exhibits moderate solubility in organic solvents, reflecting its aromatic nature, while its polar hydroxyl group may enhance solubility in polar solvents to some extent. The presence of the bromine atom introduces notable reactivity, making it a potential candidate for various chemical transformations, including nucleophilic substitutions and coupling reactions. The hydroxyl group contributes to its potential as a hydrogen bond donor, influencing its interactions in biological systems or with other chemical entities. Ethyl 5-bromo-7-hydroxy-2-benzofurancarboxylate may also exhibit interesting biological activities, which could be explored in medicinal chemistry. Overall, its structural features suggest versatility in synthetic applications and potential utility in research fields such as pharmacology and materials science.
Formula:C11H9BrO4
InChI:InChI=1S/C11H9BrO4/c1-2-15-11(14)9-4-6-3-7(12)5-8(13)10(6)16-9/h3-5,13H,2H2,1H3
InChI key:InChIKey=WKXKRKZBJVCDDX-UHFFFAOYSA-N
SMILES:OC1=C2C(C=C(C(OCC)=O)O2)=CC(Br)=C1
Synonyms:
  • 2-Benzofurancarboxylic acid, 5-bromo-7-hydroxy-, ethyl ester
  • Ethyl 5-bromo-7-hydroxy-2-benzofurancarboxylate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.