CAS 1188281-99-3

(2R,4aR,4bS,7S,9S,10aS)-7-[(1R)-1,2-Dihydroxyethyl]-1,2,3,4,4a,4b,5,6,7,9,10,10a-dodecahydro-1,1,4a,7-tetramethyl-2,9-phenanthrenediol

Description:

The chemical substance with the name "(2R,4aR,4bS,7S,9S,10aS)-7-[(1R)-1,2-Dihydroxyethyl]-1,2,3,4,4a,4b,5,6,7,9,10,10a-dodecahydro-1,1,4a,7-tetramethyl-2,9-phenanthrenediol" and CAS number "1188281-99-3" is a complex organic compound characterized by its multi-ring structure and specific stereochemistry. It features a phenanthrene core, which is a polycyclic aromatic hydrocarbon, and contains multiple chiral centers, indicating that it can exist in different stereoisomeric forms. The presence of hydroxyl groups suggests that it may exhibit alcohol-like properties, potentially influencing its solubility and reactivity. The compound's dodecahydro structure indicates a high degree of saturation, which may contribute to its stability and hydrophobic characteristics. Such compounds are often of interest in medicinal chemistry and materials science due to their potential biological activity and unique physical properties. Further studies would be necessary to elucidate its specific applications and interactions in various chemical environments.

Formula: C₂₀H₃₄O₄

InChI: InChI=1S/C20H34O4/c1-18(2)15-9-14(22)12-10-19(3,17(24)11-21)7-5-13(12)20(15,4)8-6-16(18)23/h10,13-17,21-24H,5-9,11H2,1-4H3/t13-,14+,15-,16-,17+,19+,20+/m1/s1

InChI key: InChIKey=BIPACBIPISLDRK-IFWNTPBBSA-N

SMILES: C[C@]12[C@]3(C(=C[C@]([C@H](CO)O)(C)CC3)[C@@H](O)C[C@@]1(C(C)(C)[C@H](O)CC2)[H])[H]

Synonyms:

• (2R,4aR,4bS,7S,9S,10aS)-7-[(1R)-1,2-Dihydroxyethyl]-1,2,3,4,4a,4b,5,6,7,9,10,10a-dodecahydro-1,1,4a,7-tetramethyl-2,9-phenanthrenediol
• 7-Hydroxydarutigenol
• 2,9-Phenanthrenediol, 7-[(1R)-1,2-dihydroxyethyl]-1,2,3,4,4a,4b,5,6,7,9,10,10a-dodecahydro-1,1,4a,7-tetramethyl-, (2R,4aR,4bS,7S,9S,10aS)-

7-Hydroxydarutigenol

CAS: 1188281-99-3

7-Hydroxydarutigenol is a natural product for research related to life sciences. The catalog number is TN3236 and the CAS number is 1188281-99-3.

Formula: C₂₀H₃₄O₄

Purity: 98%

Color and Shape: Solid

Molecular weight: 338.488

Ref: TM-TN3236

7β-Hydroxydarutigenol

CAS: 1188281-99-3

Formula: C₂₀H₃₄O₄

Purity: 95%~99%

Color and Shape: Powder

Molecular weight: 338.488

Ref: BP-SBP00599

7β-Hydroxydarutigenol

Controlled Product

CAS: 1188281-99-3

7β-Hydroxydarutigenol is a bioactive compound, which is a triterpenoid derivative originating from the natural source of the plant family Asteraceae. This compound is synthesized from the precursor darutigenol via hydroxylation at the 7β position. Its mode of action involves modulation of cellular pathways through interactions with specific enzymes and receptors, which can lead to anti-inflammatory, antioxidant, and other therapeutic effects.

Formula: C₂₀H₃₄O₄

Purity: Min. 95%

Molecular weight: 338.5 g/mol

Ref: 3D-NXB28199