CAS 1188282-00-9

(2S,4aS,4bR,7R,8aR)-2-[(1R)-1,2-Dihydroxyethyl]-3,4,4b,5,6,7,8,8a,9,10-decahydro-2,4b,8,8-tetramethyl-4a,7(2H)-phenanthrenediol

Description:

The chemical substance with the name "(2S,4aS,4bR,7R,8aR)-2-[(1R)-1,2-Dihydroxyethyl]-3,4,4b,5,6,7,8,8a,9,10-decahydro-2,4b,8,8-tetramethyl-4a,7(2H)-phenanthrenediol" and CAS number "1188282-00-9" is a complex organic compound characterized by its multi-ring structure and multiple stereocenters. It features a phenanthrene backbone, which is a polycyclic aromatic hydrocarbon, indicating potential aromatic properties. The presence of hydroxyl groups suggests it may exhibit alcohol-like characteristics, potentially influencing its solubility and reactivity. The specific stereochemistry, denoted by the various chiral centers, implies that the compound may have distinct biological activity or interactions, making it of interest in fields such as medicinal chemistry or biochemistry. Additionally, the presence of multiple methyl groups contributes to its hydrophobic nature, which may affect its behavior in biological systems. Overall, this compound's unique structural features suggest it could have specialized applications in pharmaceuticals or as a biochemical probe.

Formula: C₂₀H₃₄O₄

InChI: InChI=1S/C20H34O4/c1-17(2)14-6-5-13-11-18(3,16(23)12-21)9-10-20(13,24)19(14,4)8-7-15(17)22/h11,14-16,21-24H,5-10,12H2,1-4H3/t14-,15-,16+,18+,19-,20+/m1/s1

InChI key: InChIKey=PHRLIXFEBORQQV-OWJTWYAJSA-N

SMILES: C[C@]12[C@@]3(O)C(=C[C@]([C@H](CO)O)(C)CC3)CC[C@@]1(C(C)(C)[C@H](O)CC2)[H]

Synonyms:

• (2S,4aS,4bR,7R,8aR)-2-[(1R)-1,2-Dihydroxyethyl]-3,4,4b,5,6,7,8,8a,9,10-decahydro-2,4b,8,8-tetramethyl-4a,7(2H)-phenanthrenediol
• 9-Hydroxydarutigenol
• 4a,7(2H)-Phenanthrenediol, 2-[(1R)-1,2-dihydroxyethyl]-3,4,4b,5,6,7,8,8a,9,10-decahydro-2,4b,8,8-tetramethyl-, (2S,4aS,4bR,7R,8aR)-

9β-Hydroxydarutigenol

CAS: 1188282-00-9

9β-Hydroxydarutigenol is a natural product for research related to life sciences. The catalog number is TN5572 and the CAS number is 1188282-00-9.

Formula: C₂₀H₃₄O₄

Purity: 98%

Color and Shape: Solid

Molecular weight: 338.48

Ref: TM-TN5572

9β-Hydroxydarutigenol

CAS: 1188282-00-9

Formula: C₂₀H₃₄O₄

Purity: 95%~99%

Color and Shape: Powder

Molecular weight: 338.488

Ref: BP-SBP00629

9β-Hydroxydarutigenol

Controlled Product

CAS: 1188282-00-9

9β-Hydroxydarutigenol is a natural triterpenoid compound, which is isolated from the roots of the plant genus Ziziphus. It is a secondary metabolite that exhibits a complex mode of action by interacting with various molecular targets within biological systems. This interaction often results in modulation of key signaling pathways, thereby influencing various physiological and biochemical processes.

Formula: C₂₀H₃₄O₄

Purity: Min. 95%

Molecular weight: 338.5 g/mol

Ref: 3D-NXB28200