CAS 1188304-91-7

4-[3-(3-Methylphenyl)-1,2,4-oxadiazol-5-yl]-3-(methylthio)-1H-pyrazol-5-amine

Description:

4-[3-(3-Methylphenyl)-1,2,4-oxadiazol-5-yl]-3-(methylthio)-1H-pyrazol-5-amine, with the CAS number 1188304-91-7, is a chemical compound characterized by its complex structure, which includes a pyrazole ring, an oxadiazole moiety, and a methylthio group. This compound typically exhibits properties associated with heterocyclic compounds, such as potential biological activity, which may include antimicrobial or anti-inflammatory effects, although specific biological data would need to be referenced for confirmation. The presence of the methylthio group can influence its solubility and reactivity, while the oxadiazole and pyrazole rings contribute to its stability and potential interactions with biological targets. The compound's molecular structure suggests it may be of interest in pharmaceutical research, particularly in the development of new therapeutic agents. As with many organic compounds, its physical properties, such as melting point, boiling point, and solubility, would depend on the specific conditions and purity of the sample.

Formula: C₁₃H₁₃N₅OS

InChI: InChI=1S/C13H13N5OS/c1-7-4-3-5-8(6-7)11-15-12(19-18-11)9-10(14)16-17-13(9)20-2/h3-6H,1-2H3,(H3,14,16,17)

InChI key: InChIKey=VPLLZHDTFSMGJN-UHFFFAOYSA-N

SMILES: S(C)C=1C(C2=NC(=NO2)C3=CC(C)=CC=C3)=C(N)NN1