CAS 1188371-40-5

1-[2-Methyl-4-(methylsulfonyl)phenyl]-2-piperidinecarboxylic acid

Description:

1-[2-Methyl-4-(methylsulfonyl)phenyl]-2-piperidinecarboxylic acid, with the CAS number 1188371-40-5, is a chemical compound characterized by its complex structure, which includes a piperidine ring and a phenyl group substituted with a methylsulfonyl group. This compound typically exhibits properties associated with both acidic and aromatic functionalities, making it potentially useful in various chemical applications, including medicinal chemistry. The presence of the piperidine moiety suggests that it may interact with biological systems, possibly influencing neurotransmitter pathways or serving as a scaffold for drug development. Its sulfonyl group can enhance solubility and bioavailability, while the methyl substituents may affect its steric and electronic properties. The compound's stability, reactivity, and potential biological activity would depend on its specific molecular interactions and the environment in which it is used. Overall, this substance represents a class of compounds that may have significant implications in pharmaceutical research and development.

Formula: C₁₄H₁₉NO₄S

InChI: InChI=1S/C14H19NO4S/c1-10-9-11(20(2,18)19)6-7-12(10)15-8-4-3-5-13(15)14(16)17/h6-7,9,13H,3-5,8H2,1-2H3,(H,16,17)

InChI key: InChIKey=AXEQXXXPDXAHCT-UHFFFAOYSA-N

SMILES: C(O)(=O)C1N(CCCC1)C2=C(C)C=C(S(C)(=O)=O)C=C2

Synonyms:

• 1-[2-Methyl-4-(methylsulfonyl)phenyl]-2-piperidinecarboxylic acid
• 2-Piperidinecarboxylic acid, 1-[2-methyl-4-(methylsulfonyl)phenyl]-

1-[2-Methyl-4-(methylsulphonyl)phenyl]piperidine-2-carboxylic acid

CAS: 1188371-40-5

1-[2-Methyl-4-(methylsulphonyl)phenyl]piperidine-2-carboxylic acid

Purity: ≥95%

Ref: 54-OR2711