CAS 1188406-04-3

Bis[N,N′-bis(1-methylethyl)pentanimidamidato-κN,κN′]manganese

Description:

Bis[N,N′-bis(1-methylethyl)pentanimidamidato-κN,κN′]manganese is a coordination compound featuring manganese as the central metal ion, coordinated by two bidentate ligands derived from pentanimidamide. The structure is characterized by the presence of two N,N′-bis(1-methylethyl) substituents, which enhance the steric and electronic properties of the complex. This compound typically exhibits a distinctive geometry around the manganese center, often adopting a distorted octahedral configuration due to the steric bulk of the ligands. The imidamidato ligands contribute to the overall stability and reactivity of the complex, making it of interest in various chemical applications, including catalysis and materials science. The manganese center can exhibit different oxidation states, influencing its reactivity and interaction with other species. Additionally, the presence of alkyl groups in the ligands may impart hydrophobic characteristics, affecting solubility and interaction with biological systems. Overall, this compound exemplifies the intricate interplay between metal coordination chemistry and ligand design.

Formula: C₂₂H₄₆MnN₄

InChI: InChI=1S/2C11H23N2.Mn/c2*1-6-7-8-11(12-9(2)3)13-10(4)5;/h2*9-10H,6-8H2,1-5H3;/q2*-1;+2

InChI key: InChIKey=NXVOYGCJNITUHU-UHFFFAOYSA-N

SMILES: C(C)(C)[N-]1[Mn+2]2([N-](C(C)C)C(CCCC)=[N]2C(C)C)[N](C(C)C)=C1CCCC

Synonyms:

• Bis[N,N′-bis(1-methylethyl)pentanimidamidato-κN,κN′]manganese
• Manganese, bis[N,N′-bis(1-methylethyl)pentanimidamidato-κN,κN′]-

Bis(N,N'-di-i-propylpentylamidinato)manganese(II), min. 98%

CAS: 1188406-04-3

Bis(N,N'-di-i-propylpentylamidinato)manganese(II), min. 98%

Formula: C₂₂H₄₆MnN₄

Purity: min. 98%

Color and Shape: brown solid

Molecular weight: 421.57

Ref: 08-25-0230