CAS 118850-71-8
:met-gln-met-lys-lys-val-leu-asp-ser
Description:
The chemical substance known as "met-gln-met-lys-lys-val-leu-asp-ser," with the CAS number 118850-71-8, is a peptide composed of a specific sequence of amino acids. This peptide features a combination of hydrophobic and polar side chains, which contribute to its overall properties and potential biological activity. The presence of methionine (met), glutamine (gln), lysine (lys), valine (val), leucine (leu), aspartic acid (asp), and serine (ser) suggests that it may play a role in various physiological processes, possibly including signaling pathways or structural functions in proteins. Peptides like this one can exhibit diverse characteristics such as solubility in water, stability under certain pH conditions, and potential interactions with receptors or enzymes. Additionally, the sequence and composition can influence its biological activity, making it of interest in fields such as biochemistry, pharmacology, and biotechnology. Further studies would be necessary to elucidate its specific functions and applications in research or therapeutic contexts.
Formula:C45H82N12O14S2
InChI:InChI=1/C45H82N12O14S2/c1-24(2)21-31(42(67)54-32(22-35(60)61)43(68)56-33(23-58)45(70)71)55-44(69)36(25(3)4)57-41(66)28(12-8-10-18-47)52-38(63)27(11-7-9-17-46)51-40(65)30(16-20-73-6)53-39(64)29(13-14-34(49)59)50-37(62)26(48)15-19-72-5/h24-33,36,58H,7-23,46-48H2,1-6H3,(H2,49,59)(H,50,62)(H,51,65)(H,52,63)(H,53,64)(H,54,67)(H,55,69)(H,56,68)(H,57,66)(H,60,61)(H,70,71)/t26-,27-,28?,29-,30?,31?,32-,33-,36-/m0/s1
SMILES:CC(C)CC(C(=N[C@@H](CC(=O)O)C(=N[C@@H](CO)C(=O)O)O)O)N=C([C@H](C(C)C)N=C(C(CCCCN)N=C([C@H](CCCCN)N=C(C(CCSC)N=C([C@H](CCC(=N)O)N=C([C@H](CCSC)N)O)O)O)O)O)O
Synonyms:- H-Met-Gln-Met-Lys-Lys-Val-Leu-Asp-Ser-OH
- Anti-Inflammatory Peptide 1
- L-methionyl-L-glutaminylmethionyl-L-lysyllysyl-L-valylleucyl-L-alpha-aspartyl-L-serine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
Anti-Inflammatory Peptide 1
CAS:Anti-Inflammatory Peptide 1 is a peptide that has been shown to have anti-inflammatory properties. It is synthesized from H-Met-Gln-Met-Lys-Lys-Val-Leu-Asp-Ser-OH, with the hydroxyl group linked by an ester bond to the N terminal of the peptide. Antiinflammatory peptides can be used as potential biomarkers for inflammatory diseases or as a treatment for these diseases.Formula:C45H82N12O14S2Purity:Min. 95%Molecular weight:1,079.34 g/mol
