CAS 118853-60-4

Pyrazinecarboxylic acid, 6-amino-, methyl ester (9CI)

Description:

Pyrazinecarboxylic acid, 6-amino-, methyl ester (9CI), with the CAS number 118853-60-4, is an organic compound characterized by its pyrazine ring structure, which is a six-membered aromatic heterocycle containing two nitrogen atoms. This compound features a carboxylic acid functional group and an amino group at the 6-position of the pyrazine ring, along with a methyl ester group. The presence of these functional groups contributes to its polar nature, making it soluble in polar solvents. Pyrazine derivatives are often studied for their biological activities, including potential antimicrobial and anti-inflammatory properties. The methyl ester form can influence the compound's reactivity and bioavailability. Additionally, this compound may be utilized in various synthetic applications, including the development of pharmaceuticals and agrochemicals. Its specific properties, such as melting point, boiling point, and reactivity, would depend on the molecular interactions and the environment in which it is used. Overall, pyrazinecarboxylic acid, 6-amino-, methyl ester is a versatile compound with potential applications in medicinal chemistry and material science.

Formula: C₆H₇N₃O₂

InChI: InChI=1/C6H7N3O2/c1-11-6(10)4-2-8-3-5(7)9-4/h2-3H,1H3,(H2,7,9)

SMILES: COC(=O)c1cncc(N)n1

Synonyms:

• Pyrazinecarboxylic acid, 6-amino-, methyl ester

Methyl 6-aminopyrazine-2-carboxylate

CAS: 118853-60-4

Formula: C₆H₇N₃O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 153.1387

Ref: IN-DA0080T6

Methyl 6-aminopyrazine-2-carboxylate

CAS: 118853-60-4

Methyl 6-aminopyrazine-2-carboxylate

Purity: 95%

Molecular weight: 153.14g/mol

Ref: 54-OR302497

Methyl 6-aminopyrazine-2-carboxylate

CAS: 118853-60-4

Formula: C₆H₇N₃O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 153.141

Ref: 10-F077207