CymitQuimica logo

CAS 118863-94-8

:

(5-amino-1,3,4-thiadiazol-2-yl)acetic acid

Description:
(5-amino-1,3,4-thiadiazol-2-yl)acetic acid is a heterocyclic compound characterized by the presence of a thiadiazole ring, which contributes to its unique chemical properties. The structure features an amino group and a carboxylic acid functional group, making it an amino acid derivative. This compound is typically soluble in polar solvents due to its ability to form hydrogen bonds, and its acidic nature allows it to participate in various chemical reactions, including those involving nucleophiles and electrophiles. The thiadiazole moiety can also impart biological activity, making it of interest in pharmaceutical research. Its potential applications may include use as a building block in drug synthesis or as a biochemical probe. The compound's stability and reactivity can be influenced by factors such as pH and temperature, which are important considerations in both laboratory and industrial settings. Overall, (5-amino-1,3,4-thiadiazol-2-yl)acetic acid is a versatile compound with significant implications in chemistry and biochemistry.
Formula:C4H5N3O2S
InChI:InChI=1/C4H5N3O2S/c5-4-7-6-2(10-4)1-3(8)9/h1H2,(H2,5,7)(H,8,9)
SMILES:C(c1n[nH]c(=N)s1)C(=O)O
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.