CAS 118876-55-4
:5-amino-6-[(Z)-(4-chlorophenyl)azo]naphthalene-1-sulfonamide
Description:
5-amino-6-[(Z)-(4-chlorophenyl)azo]naphthalene-1-sulfonamide, with CAS number 118876-55-4, is an organic compound characterized by its azo group, which is a functional group containing a nitrogen-nitrogen double bond (–N=N–). This compound features a naphthalene backbone, which contributes to its aromatic properties, and a sulfonamide group that enhances its solubility in polar solvents. The presence of the amino group indicates potential for hydrogen bonding, which can influence its reactivity and interaction with biological systems. The (Z) configuration of the azo linkage suggests a specific geometric arrangement that can affect the compound's optical properties and reactivity. Additionally, the 4-chlorophenyl substituent introduces a halogen, which can impact the compound's electronic properties and stability. Overall, this compound may exhibit applications in dye chemistry, pharmaceuticals, or as a reagent in various chemical reactions, owing to its unique structural features and functional groups.
Formula:C16H13ClN4O2S
InChI:InChI=1/C16H13ClN4O2S/c17-10-4-6-11(7-5-10)20-21-14-9-8-12-13(16(14)18)2-1-3-15(12)24(19,22)23/h1-9H,18H2,(H2,19,22,23)/b21-20-
SMILES:c1cc2c(ccc(c2N)/N=N\c2ccc(cc2)Cl)c(c1)S(=O)(=O)N
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.