CAS 118876-57-6
:2,3-dihydroxy-7-sulfamoylbenzo(f)quinoxaline
Description:
2,3-Dihydroxy-7-sulfamoylbenzo(f)quinoxaline is a chemical compound characterized by its complex structure, which includes a quinoxaline core substituted with hydroxyl and sulfonamide groups. The presence of two hydroxyl (-OH) groups at the 2 and 3 positions contributes to its potential as a biological active molecule, possibly influencing its solubility and reactivity. The sulfonamide group at the 7 position may impart antibacterial properties, as sulfonamides are known for their role in inhibiting bacterial growth. This compound is likely to exhibit polar characteristics due to the functional groups, which can affect its interaction with biological systems and its overall pharmacokinetics. Additionally, the compound may have applications in medicinal chemistry, particularly in the development of therapeutic agents. Its specific reactivity and biological activity would depend on the context of its use, including the presence of other functional groups and the environment in which it is applied. Overall, 2,3-dihydroxy-7-sulfamoylbenzo(f)quinoxaline represents a class of compounds with potential utility in various chemical and pharmaceutical applications.
Formula:C12H9N3O4S
InChI:InChI=1/C12H9N3O4S/c13-20(18,19)9-3-1-2-7-6(9)4-5-8-10(7)15-12(17)11(16)14-8/h1-5H,(H,14,16)(H,15,17)(H2,13,18,19)
SMILES:c1cc2c(ccc3c2[nH]c(=O)c(=O)[nH]3)c(c1)S(=O)(=O)N
Synonyms:- Bqx-cpd
- Benzo(f)quinoxaline-7-sulfonamide, 1,2,3,4-tetrahydro-2,3-dioxo-
- 2,3-Dioxo-1,2,3,4-Tetrahydrobenzo[F]Quinoxaline-7-Sulfonamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2,3-Dihydroxy-7-sulphamoyl-benzo[f]quinoxaline
CAS:Controlled ProductApplications 2,3-Dihydroxy-7-sulphamoyl-benzo[f]quinoxaline (cas# 118876-57-6) is a compound useful in organic synthesis.
Formula:C12H9N3O4SColor and Shape:NeatMolecular weight:291.28
