CAS 118878-53-8

D-Alloisoleucine, methyl ester

Description:

D-Alloisoleucine, methyl ester is an amino acid derivative characterized by its structural features that include a branched-chain configuration typical of isoleucine. As a methyl ester, it possesses a methoxy group (-OCH3) attached to the carboxylic acid functional group, which enhances its solubility in organic solvents and may influence its biological activity. This compound is often studied in the context of peptide synthesis and may exhibit unique properties in terms of stereochemistry due to the presence of the D-enantiomer. D-Alloisoleucine, methyl ester is relevant in various biochemical applications, including studies on protein structure and function, as well as potential therapeutic uses. Its CAS number, 118878-53-8, allows for precise identification in chemical databases. The compound's stability, reactivity, and interactions with other biomolecules can vary based on environmental conditions such as pH and temperature, making it a subject of interest in both synthetic and medicinal chemistry.

Formula: C₇H₁₅NO₂

InChI: InChI=1S/C7H15NO2/c1-4-5(2)6(8)7(9)10-3/h5-6H,4,8H2,1-3H3/t5-,6+/m0/s1

InChI key: InChIKey=YXMMTUJDQTVJEN-NTSWFWBYSA-N

SMILES: [C@@H]([C@H](CC)C)(C(OC)=O)N

Synonyms:

• D-Alloisoleucine, methyl ester
• D-allo-Isoleucine methyl ester